C13H16BrN5O3 — CID 19517919
methyl 4-[[2-(4-bromo-5-methylpyrazol-1-yl)acetyl]amino]-1-ethylpyrazole-3-carboxylate (PubChem CID 19517919) has the molecular formula C13H16BrN5O3 and a molecular weight of 370.21 g/mol. Its IUPAC name is methyl 4-[[2-(4-bromo-5-methylpyrazol-1-yl)acetyl]amino]-1-ethylpyrazole-3-carboxylate.
| Compound Name | methyl 4-[[2-(4-bromo-5-methylpyrazol-1-yl)acetyl]amino]-1-ethylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 19517919 |
| Molecular Formula | C13H16BrN5O3 |
| Molecular Weight | 370.21 g/mol |
| Exact Mass | 369.04 |
| IUPAC Name | methyl 4-[[2-(4-bromo-5-methylpyrazol-1-yl)acetyl]amino]-1-ethylpyrazole-3-carboxylate |
| SMILES | CCn1cc(NC(=O)Cn2ncc(Br)c2C)c(C(=O)OC)n1 |
| InChI | InChI=1S/C13H16BrN5O3/c1-4-18-6-10(12(17-18)13(21)22-3)16-11(20)7-19-8(2)9(14)5-15-19/h5-6H,4,7H2,1-3H3,(H,16,20) |
| InChIKey | XQPBMNPXCWYJLR-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 91.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.21 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |