C8H12ClN3O2 — CID 19518354
2-(4-chloro-3-methylpyrazol-1-yl)-N-(2-hydroxyethyl)acetamide (PubChem CID 19518354) has the molecular formula C8H12ClN3O2 and a molecular weight of 217.66 g/mol. Its IUPAC name is 2-(4-chloro-3-methylpyrazol-1-yl)-N-(2-hydroxyethyl)acetamide.
| Compound Name | 2-(4-chloro-3-methylpyrazol-1-yl)-N-(2-hydroxyethyl)acetamide |
|---|---|
| PubChem CID | 19518354 |
| Molecular Formula | C8H12ClN3O2 |
| Molecular Weight | 217.66 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | 2-(4-chloro-3-methylpyrazol-1-yl)-N-(2-hydroxyethyl)acetamide |
| SMILES | Cc1nn(CC(=O)NCCO)cc1Cl |
| InChI | InChI=1S/C8H12ClN3O2/c1-6-7(9)4-12(11-6)5-8(14)10-2-3-13/h4,13H,2-3,5H2,1H3,(H,10,14) |
| InChIKey | SYDKKQCAVJLLHL-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.66 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |