C17H17F2N5O — CID 19519463
2-[3-(difluoromethyl)-5-methylpyrazol-1-yl]-N-[3-(pyrazol-1-ylmethyl)phenyl]acetamide (PubChem CID 19519463) has the molecular formula C17H17F2N5O and a molecular weight of 345.35 g/mol. Its IUPAC name is 2-[3-(difluoromethyl)-5-methylpyrazol-1-yl]-N-[3-(pyrazol-1-ylmethyl)phenyl]acetamide.
| Compound Name | 2-[3-(difluoromethyl)-5-methylpyrazol-1-yl]-N-[3-(pyrazol-1-ylmethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 19519463 |
| Molecular Formula | C17H17F2N5O |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 2-[3-(difluoromethyl)-5-methylpyrazol-1-yl]-N-[3-(pyrazol-1-ylmethyl)phenyl]acetamide |
| SMILES | Cc1cc(C(F)F)nn1CC(=O)Nc1cccc(Cn2cccn2)c1 |
| InChI | InChI=1S/C17H17F2N5O/c1-12-8-15(17(18)19)22-24(12)11-16(25)21-14-5-2-4-13(9-14)10-23-7-3-6-20-23/h2-9,17H,10-11H2,1H3,(H,21,25) |
| InChIKey | PHYXTTTXWQBIKP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |