C15H19ClF3N3O2 — CID 19523661
4-[[2-[3-(trifluoromethyl)-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazol-1-yl]acetyl]amino]butanoyl chloride (PubChem CID 19523661) has the molecular formula C15H19ClF3N3O2 and a molecular weight of 365.78 g/mol. Its IUPAC name is 4-[[2-[3-(trifluoromethyl)-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazol-1-yl]acetyl]amino]butanoyl chloride.
| Compound Name | 4-[[2-[3-(trifluoromethyl)-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazol-1-yl]acetyl]amino]butanoyl chloride |
|---|---|
| PubChem CID | 19523661 |
| Molecular Formula | C15H19ClF3N3O2 |
| Molecular Weight | 365.78 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 4-[[2-[3-(trifluoromethyl)-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazol-1-yl]acetyl]amino]butanoyl chloride |
| SMILES | O=C(Cl)CCCNC(=O)Cn1nc(C(F)(F)F)c2c1CCCCC2 |
| InChI | InChI=1S/C15H19ClF3N3O2/c16-12(23)7-4-8-20-13(24)9-22-11-6-3-1-2-5-10(11)14(21-22)15(17,18)19/h1-9H2,(H,20,24) |
| InChIKey | BOIBGRXUNOFOGI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.78 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|