About 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-hexylacetamide
2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-hexylacetamide (PubChem CID 19525424) has the molecular formula C13H22BrN3O
and a molecular weight of 316.24 g/mol. Its IUPAC name is 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-hexylacetamide.
Molecular Properties
| Compound Name | 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-hexylacetamide |
| PubChem CID | 19525424 |
| Molecular Formula | C13H22BrN3O |
| Molecular Weight | 316.24 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-hexylacetamide |
| SMILES | CCCCCCNC(=O)Cn1nc(C)c(Br)c1C |
| InChI | InChI=1S/C13H22BrN3O/c1-4-5-6-7-8-15-12(18)9-17-11(3)13(14)10(2)16-17/h4-9H2,1-3H3,(H,15,18) |
| InChIKey | AYVYDPWILCHWGD-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.24 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-hexylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-hexylacetamide?
The IUPAC name of 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-hexylacetamide (CID 19525424) is 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-hexylacetamide.
What is the SMILES notation for 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-hexylacetamide?
The canonical SMILES for 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-hexylacetamide is CCCCCCNC(=O)Cn1nc(C)c(Br)c1C.
What is the InChIKey of 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-hexylacetamide?
The InChIKey is AYVYDPWILCHWGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22BrN3O/c1-4-5-6-7-8-15-12(18)9-17-11(3)13(14)10(2)16-17/h4-9H2,1-3H3,(H,15,18).
What are the key properties of 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-hexylacetamide?
2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-hexylacetamide has a molecular weight of 316.24 g/mol, XLogP of 2.96, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-hexylacetamide is sourced from PubChem (CID 19525424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).