C15H12ClF3N4O4 — CID 19527281
2-[4-chloro-5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]-N-(2-hydroxy-5-nitrophenyl)acetamide (PubChem CID 19527281) has the molecular formula C15H12ClF3N4O4 and a molecular weight of 404.73 g/mol. Its IUPAC name is 2-[4-chloro-5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]-N-(2-hydroxy-5-nitrophenyl)acetamide.
| Compound Name | 2-[4-chloro-5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]-N-(2-hydroxy-5-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 19527281 |
| Molecular Formula | C15H12ClF3N4O4 |
| Molecular Weight | 404.73 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | 2-[4-chloro-5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]-N-(2-hydroxy-5-nitrophenyl)acetamide |
| SMILES | O=C(Cn1nc(C(F)(F)F)c(Cl)c1C1CC1)Nc1cc([N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C15H12ClF3N4O4/c16-12-13(7-1-2-7)22(21-14(12)15(17,18)19)6-11(25)20-9-5-8(23(26)27)3-4-10(9)24/h3-5,7,24H,1-2,6H2,(H,20,25) |
| InChIKey | YLMASMMPGGWBOT-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.73 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|