C17H21FN4O — CID 19527457
1-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]-2-(5-methylpyrazol-1-yl)ethanone (PubChem CID 19527457) has the molecular formula C17H21FN4O and a molecular weight of 316.38 g/mol. Its IUPAC name is 1-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]-2-(5-methylpyrazol-1-yl)ethanone.
| Compound Name | 1-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]-2-(5-methylpyrazol-1-yl)ethanone |
|---|---|
| PubChem CID | 19527457 |
| Molecular Formula | C17H21FN4O |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 1-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]-2-(5-methylpyrazol-1-yl)ethanone |
| SMILES | Cc1ccnn1CC(=O)N1CCN(Cc2ccccc2F)CC1 |
| InChI | InChI=1S/C17H21FN4O/c1-14-6-7-19-22(14)13-17(23)21-10-8-20(9-11-21)12-15-4-2-3-5-16(15)18/h2-7H,8-13H2,1H3 |
| InChIKey | NDJJKGAIJJOGHY-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |