C16H17F2N5O3 — CID 19531329
1-[4-[(2,3-difluorophenyl)methyl]piperazin-1-yl]-2-(4-nitropyrazol-1-yl)ethanone (PubChem CID 19531329) has the molecular formula C16H17F2N5O3 and a molecular weight of 365.34 g/mol. Its IUPAC name is 1-[4-[(2,3-difluorophenyl)methyl]piperazin-1-yl]-2-(4-nitropyrazol-1-yl)ethanone.
| Compound Name | 1-[4-[(2,3-difluorophenyl)methyl]piperazin-1-yl]-2-(4-nitropyrazol-1-yl)ethanone |
|---|---|
| PubChem CID | 19531329 |
| Molecular Formula | C16H17F2N5O3 |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 1-[4-[(2,3-difluorophenyl)methyl]piperazin-1-yl]-2-(4-nitropyrazol-1-yl)ethanone |
| SMILES | O=C(Cn1cc([N+](=O)[O-])cn1)N1CCN(Cc2cccc(F)c2F)CC1 |
| InChI | InChI=1S/C16H17F2N5O3/c17-14-3-1-2-12(16(14)18)9-20-4-6-21(7-5-20)15(24)11-22-10-13(8-19-22)23(25)26/h1-3,8,10H,4-7,9,11H2 |
| InChIKey | SSQIQCPIHBAYAZ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 84.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|