C13H17ClF3N3O3S — CID 19531877
ethyl (2R)-2-[2-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propanoylamino]-3-sulfanylpropanoate (PubChem CID 19531877) has the molecular formula C13H17ClF3N3O3S and a molecular weight of 387.81 g/mol. Its IUPAC name is ethyl (2R)-2-[2-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propanoylamino]-3-sulfanylpropanoate.
| Compound Name | ethyl (2R)-2-[2-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propanoylamino]-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 19531877 |
| Molecular Formula | C13H17ClF3N3O3S |
| Molecular Weight | 387.81 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | ethyl (2R)-2-[2-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propanoylamino]-3-sulfanylpropanoate |
| SMILES | CCOC(=O)[C@H](CS)NC(=O)C(C)n1nc(C(F)(F)F)c(Cl)c1C |
| InChI | InChI=1S/C13H17ClF3N3O3S/c1-4-23-12(22)8(5-24)18-11(21)7(3)20-6(2)9(14)10(19-20)13(15,16)17/h7-8,24H,4-5H2,1-3H3,(H,18,21)/t7?,8-/m0/s1 |
| InChIKey | WOABDSYBLNXNNW-MQWKRIRWSA-N |
| XLogP | 2.40 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.81 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|