C14H20ClF4N3O — CID 19535664
2-[4-chloro-3,5-bis(difluoromethyl)pyrazol-1-yl]-N-hexylpropanamide (PubChem CID 19535664) has the molecular formula C14H20ClF4N3O and a molecular weight of 357.78 g/mol. Its IUPAC name is 2-[4-chloro-3,5-bis(difluoromethyl)pyrazol-1-yl]-N-hexylpropanamide.
| Compound Name | 2-[4-chloro-3,5-bis(difluoromethyl)pyrazol-1-yl]-N-hexylpropanamide |
|---|---|
| PubChem CID | 19535664 |
| Molecular Formula | C14H20ClF4N3O |
| Molecular Weight | 357.78 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 2-[4-chloro-3,5-bis(difluoromethyl)pyrazol-1-yl]-N-hexylpropanamide |
| SMILES | CCCCCCNC(=O)C(C)n1nc(C(F)F)c(Cl)c1C(F)F |
| InChI | InChI=1S/C14H20ClF4N3O/c1-3-4-5-6-7-20-14(23)8(2)22-11(13(18)19)9(15)10(21-22)12(16)17/h8,12-13H,3-7H2,1-2H3,(H,20,23) |
| InChIKey | VUIGEVFDDLIWMD-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.78 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|