C14H19BrN6O3 — CID 19536072
N-[(4-bromo-1-ethylpyrazol-3-yl)methyl]-N-methyl-2-(5-methyl-3-nitropyrazol-1-yl)propanamide (PubChem CID 19536072) has the molecular formula C14H19BrN6O3 and a molecular weight of 399.25 g/mol. Its IUPAC name is N-[(4-bromo-1-ethylpyrazol-3-yl)methyl]-N-methyl-2-(5-methyl-3-nitropyrazol-1-yl)propanamide.
| Compound Name | N-[(4-bromo-1-ethylpyrazol-3-yl)methyl]-N-methyl-2-(5-methyl-3-nitropyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 19536072 |
| Molecular Formula | C14H19BrN6O3 |
| Molecular Weight | 399.25 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | N-[(4-bromo-1-ethylpyrazol-3-yl)methyl]-N-methyl-2-(5-methyl-3-nitropyrazol-1-yl)propanamide |
| SMILES | CCn1cc(Br)c(CN(C)C(=O)C(C)n2nc([N+](=O)[O-])cc2C)n1 |
| InChI | InChI=1S/C14H19BrN6O3/c1-5-19-7-11(15)12(16-19)8-18(4)14(22)10(3)20-9(2)6-13(17-20)21(23)24/h6-7,10H,5,8H2,1-4H3 |
| InChIKey | WEBDUVLKBKTDTL-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 99.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.25 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|