C18H17F3N6O3 — CID 19538883
2-(5-methyl-3-nitropyrazol-1-yl)-N-[1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]propanamide (PubChem CID 19538883) has the molecular formula C18H17F3N6O3 and a molecular weight of 422.37 g/mol. Its IUPAC name is 2-(5-methyl-3-nitropyrazol-1-yl)-N-[1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]propanamide.
| Compound Name | 2-(5-methyl-3-nitropyrazol-1-yl)-N-[1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]propanamide |
|---|---|
| PubChem CID | 19538883 |
| Molecular Formula | C18H17F3N6O3 |
| Molecular Weight | 422.37 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | 2-(5-methyl-3-nitropyrazol-1-yl)-N-[1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]propanamide |
| SMILES | Cc1cc([N+](=O)[O-])nn1C(C)C(=O)Nc1cnn(Cc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C18H17F3N6O3/c1-11-6-16(27(29)30)24-26(11)12(2)17(28)23-15-8-22-25(10-15)9-13-4-3-5-14(7-13)18(19,20)21/h3-8,10,12H,9H2,1-2H3,(H,23,28) |
| InChIKey | RQVNOSFCBSROFO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.37 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|