About 3-phenoxybenzoic acid
3-phenoxybenzoic acid (PubChem CID 19539) has the molecular formula C13H10O3
and a molecular weight of 214.22 g/mol. Its IUPAC name is 3-phenoxybenzoic acid.
Molecular Properties
| Compound Name | 3-phenoxybenzoic acid |
| PubChem CID | 19539 |
| Molecular Formula | C13H10O3 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 3-phenoxybenzoic acid |
| SMILES | O=C(O)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C13H10O3/c14-13(15)10-5-4-8-12(9-10)16-11-6-2-1-3-7-11/h1-9H,(H,14,15) |
| InChIKey | NXTDJHZGHOFSQG-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-phenoxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenoxybenzoic acid?
The IUPAC name of 3-phenoxybenzoic acid (CID 19539) is 3-phenoxybenzoic acid.
What is the SMILES notation for 3-phenoxybenzoic acid?
The canonical SMILES for 3-phenoxybenzoic acid is O=C(O)c1cccc(Oc2ccccc2)c1.
What is the InChIKey of 3-phenoxybenzoic acid?
The InChIKey is NXTDJHZGHOFSQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O3/c14-13(15)10-5-4-8-12(9-10)16-11-6-2-1-3-7-11/h1-9H,(H,14,15).
What are the key properties of 3-phenoxybenzoic acid?
3-phenoxybenzoic acid has a molecular weight of 214.22 g/mol, XLogP of 3.18, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenoxybenzoic acid is sourced from PubChem (CID 19539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).