C13H12N2O3 — CID 19540733
(E)-1-(2,4-dihydroxyphenyl)-3-(1-methylpyrazol-3-yl)prop-2-en-1-one (PubChem CID 19540733) has the molecular formula C13H12N2O3 and a molecular weight of 244.25 g/mol. Its IUPAC name is (E)-1-(2,4-dihydroxyphenyl)-3-(1-methylpyrazol-3-yl)prop-2-en-1-one.
| Compound Name | (E)-1-(2,4-dihydroxyphenyl)-3-(1-methylpyrazol-3-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19540733 |
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | (E)-1-(2,4-dihydroxyphenyl)-3-(1-methylpyrazol-3-yl)prop-2-en-1-one |
| SMILES | Cn1ccc(/C=C/C(=O)c2ccc(O)cc2O)n1 |
| InChI | InChI=1S/C13H12N2O3/c1-15-7-6-9(14-15)2-5-12(17)11-4-3-10(16)8-13(11)18/h2-8,16,18H,1H3/b5-2+ |
| InChIKey | SIHRMNDTNCXNJB-GORDUTHDSA-N |
| XLogP | 1.73 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|