C15H14F4N2O4 — CID 19542425
methyl 2-[5-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]-1,3,4-oxadiazol-2-yl]acetate (PubChem CID 19542425) has the molecular formula C15H14F4N2O4 and a molecular weight of 362.28 g/mol. Its IUPAC name is methyl 2-[5-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]-1,3,4-oxadiazol-2-yl]acetate.
| Compound Name | methyl 2-[5-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]-1,3,4-oxadiazol-2-yl]acetate |
|---|---|
| PubChem CID | 19542425 |
| Molecular Formula | C15H14F4N2O4 |
| Molecular Weight | 362.28 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | methyl 2-[5-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]-1,3,4-oxadiazol-2-yl]acetate |
| SMILES | COC(=O)Cc1nnc(-c2cccc(COCC(F)(F)C(F)F)c2)o1 |
| InChI | InChI=1S/C15H14F4N2O4/c1-23-12(22)6-11-20-21-13(25-11)10-4-2-3-9(5-10)7-24-8-15(18,19)14(16)17/h2-5,14H,6-8H2,1H3 |
| InChIKey | JHAMYQPGNLPUKA-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.28 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|