C14H13ClN2OS — CID 19545431
(5E)-5-[(Z)-2-chloro-3-phenylprop-2-enylidene]-3-ethyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 19545431) has the molecular formula C14H13ClN2OS and a molecular weight of 292.79 g/mol. Its IUPAC name is (5E)-5-[(Z)-2-chloro-3-phenylprop-2-enylidene]-3-ethyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[(Z)-2-chloro-3-phenylprop-2-enylidene]-3-ethyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 19545431 |
| Molecular Formula | C14H13ClN2OS |
| Molecular Weight | 292.79 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | (5E)-5-[(Z)-2-chloro-3-phenylprop-2-enylidene]-3-ethyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C\C(Cl)=C\c2ccccc2)NC1=S |
| InChI | InChI=1S/C14H13ClN2OS/c1-2-17-13(18)12(16-14(17)19)9-11(15)8-10-6-4-3-5-7-10/h3-9H,2H2,1H3,(H,16,19)/b11-8-,12-9+ |
| InChIKey | JHJRHJDOJDQORR-QABOREQESA-N |
| XLogP | 2.89 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.79 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|