C22H14FN3O3S — CID 19545754
4-[[5-[(E)-[1-(4-fluorophenyl)-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]furan-2-yl]methoxy]benzonitrile (PubChem CID 19545754) has the molecular formula C22H14FN3O3S and a molecular weight of 419.44 g/mol. Its IUPAC name is 4-[[5-[(E)-[1-(4-fluorophenyl)-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]furan-2-yl]methoxy]benzonitrile.
| Compound Name | 4-[[5-[(E)-[1-(4-fluorophenyl)-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]furan-2-yl]methoxy]benzonitrile |
|---|---|
| PubChem CID | 19545754 |
| Molecular Formula | C22H14FN3O3S |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | 4-[[5-[(E)-[1-(4-fluorophenyl)-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]furan-2-yl]methoxy]benzonitrile |
| SMILES | N#Cc1ccc(OCc2ccc(/C=C3/NC(=S)N(c4ccc(F)cc4)C3=O)o2)cc1 |
| InChI | InChI=1S/C22H14FN3O3S/c23-15-3-5-16(6-4-15)26-21(27)20(25-22(26)30)11-18-9-10-19(29-18)13-28-17-7-1-14(12-24)2-8-17/h1-11H,13H2,(H,25,30)/b20-11+ |
| InChIKey | SKVKDOFEWTVERP-RGVLZGJSSA-N |
| XLogP | 4.13 |
| TPSA | 78.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|