C31H34N2O4S — CID 19546683
(5E)-5-[[3-[(2-tert-butyl-5-methylphenoxy)methyl]-4-methoxyphenyl]methylidene]-3-(2-ethoxyphenyl)-2-sulfanylideneimidazolidin-4-one (PubChem CID 19546683) has the molecular formula C31H34N2O4S and a molecular weight of 530.69 g/mol. Its IUPAC name is (5E)-5-[[3-[(2-tert-butyl-5-methylphenoxy)methyl]-4-methoxyphenyl]methylidene]-3-(2-ethoxyphenyl)-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[[3-[(2-tert-butyl-5-methylphenoxy)methyl]-4-methoxyphenyl]methylidene]-3-(2-ethoxyphenyl)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 19546683 |
| Molecular Formula | C31H34N2O4S |
| Molecular Weight | 530.69 g/mol |
| Exact Mass | 530.22 |
| IUPAC Name | (5E)-5-[[3-[(2-tert-butyl-5-methylphenoxy)methyl]-4-methoxyphenyl]methylidene]-3-(2-ethoxyphenyl)-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCOc1ccccc1N1C(=O)/C(=C\c2ccc(OC)c(COc3cc(C)ccc3C(C)(C)C)c2)NC1=S |
| InChI | InChI=1S/C31H34N2O4S/c1-7-36-27-11-9-8-10-25(27)33-29(34)24(32-30(33)38)18-21-13-15-26(35-6)22(17-21)19-37-28-16-20(2)12-14-23(28)31(3,4)5/h8-18H,7,19H2,1-6H3,(H,32,38)/b24-18+ |
| InChIKey | DPLZWXRLXLMOAE-HKOYGPOVSA-N |
| XLogP | 6.54 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.69 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|