C21H22N2OS — CID 19548068
(5E)-5-[(4-tert-butylphenyl)methylidene]-3-(2-methylphenyl)-2-sulfanylideneimidazolidin-4-one (PubChem CID 19548068) has the molecular formula C21H22N2OS and a molecular weight of 350.49 g/mol. Its IUPAC name is (5E)-5-[(4-tert-butylphenyl)methylidene]-3-(2-methylphenyl)-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[(4-tert-butylphenyl)methylidene]-3-(2-methylphenyl)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 19548068 |
| Molecular Formula | C21H22N2OS |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | (5E)-5-[(4-tert-butylphenyl)methylidene]-3-(2-methylphenyl)-2-sulfanylideneimidazolidin-4-one |
| SMILES | Cc1ccccc1N1C(=O)/C(=C\c2ccc(C(C)(C)C)cc2)NC1=S |
| InChI | InChI=1S/C21H22N2OS/c1-14-7-5-6-8-18(14)23-19(24)17(22-20(23)25)13-15-9-11-16(12-10-15)21(2,3)4/h5-13H,1-4H3,(H,22,25)/b17-13+ |
| InChIKey | QMOYCQHKTFFEGM-GHRIWEEISA-N |
| XLogP | 4.55 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|