C12H12N2OS2 — CID 19548623
(5E)-3-cyclopropyl-5-[(3-methylthiophen-2-yl)methylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 19548623) has the molecular formula C12H12N2OS2 and a molecular weight of 264.37 g/mol. Its IUPAC name is (5E)-3-cyclopropyl-5-[(3-methylthiophen-2-yl)methylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-3-cyclopropyl-5-[(3-methylthiophen-2-yl)methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 19548623 |
| Molecular Formula | C12H12N2OS2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | (5E)-3-cyclopropyl-5-[(3-methylthiophen-2-yl)methylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | Cc1ccsc1/C=C1/NC(=S)N(C2CC2)C1=O |
| InChI | InChI=1S/C12H12N2OS2/c1-7-4-5-17-10(7)6-9-11(15)14(8-2-3-8)12(16)13-9/h4-6,8H,2-3H2,1H3,(H,13,16)/b9-6+ |
| InChIKey | AQAFTKWWWMNUAY-RMKNXTFCSA-N |
| XLogP | 2.28 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|