C25H22F4N4O2S — CID 19549166
(5E)-5-[[3-[[3,5-bis(difluoromethyl)pyrazol-1-yl]methyl]-4-methoxyphenyl]methylidene]-3-(2-ethylphenyl)-2-sulfanylideneimidazolidin-4-one (PubChem CID 19549166) has the molecular formula C25H22F4N4O2S and a molecular weight of 518.54 g/mol. Its IUPAC name is (5E)-5-[[3-[[3,5-bis(difluoromethyl)pyrazol-1-yl]methyl]-4-methoxyphenyl]methylidene]-3-(2-ethylphenyl)-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[[3-[[3,5-bis(difluoromethyl)pyrazol-1-yl]methyl]-4-methoxyphenyl]methylidene]-3-(2-ethylphenyl)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 19549166 |
| Molecular Formula | C25H22F4N4O2S |
| Molecular Weight | 518.54 g/mol |
| Exact Mass | 518.14 |
| IUPAC Name | (5E)-5-[[3-[[3,5-bis(difluoromethyl)pyrazol-1-yl]methyl]-4-methoxyphenyl]methylidene]-3-(2-ethylphenyl)-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCc1ccccc1N1C(=O)/C(=C\c2ccc(OC)c(Cn3nc(C(F)F)cc3C(F)F)c2)NC1=S |
| InChI | InChI=1S/C25H22F4N4O2S/c1-3-15-6-4-5-7-19(15)33-24(34)18(30-25(33)36)11-14-8-9-21(35-2)16(10-14)13-32-20(23(28)29)12-17(31-32)22(26)27/h4-12,22-23H,3,13H2,1-2H3,(H,30,36)/b18-11+ |
| InChIKey | WWLCJXFZKUOQPV-WOJGMQOQSA-N |
| XLogP | 5.64 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.54 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|