C13H15F3N6O4 — CID 19551817
2-(4-nitropyrazol-1-yl)-N-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]butanamide (PubChem CID 19551817) has the molecular formula C13H15F3N6O4 and a molecular weight of 376.30 g/mol. Its IUPAC name is 2-(4-nitropyrazol-1-yl)-N-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]butanamide.
| Compound Name | 2-(4-nitropyrazol-1-yl)-N-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]butanamide |
|---|---|
| PubChem CID | 19551817 |
| Molecular Formula | C13H15F3N6O4 |
| Molecular Weight | 376.30 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 2-(4-nitropyrazol-1-yl)-N-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]butanamide |
| SMILES | CCC(C(=O)Nc1cnn(COCC(F)(F)F)c1)n1cc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C13H15F3N6O4/c1-2-11(21-6-10(4-18-21)22(24)25)12(23)19-9-3-17-20(5-9)8-26-7-13(14,15)16/h3-6,11H,2,7-8H2,1H3,(H,19,23) |
| InChIKey | XPOFBDYWWYVPTO-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 117.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.30 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|