C15H22N2O — CID 19552810
2-(3,5-dimethyl-1-adamantyl)-5-methyl-1,3,4-oxadiazole (PubChem CID 19552810) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1-adamantyl)-5-methyl-1,3,4-oxadiazole.
| Compound Name | 2-(3,5-dimethyl-1-adamantyl)-5-methyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 19552810 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 2-(3,5-dimethyl-1-adamantyl)-5-methyl-1,3,4-oxadiazole |
| SMILES | Cc1nnc(C23CC4CC(C)(CC(C)(C4)C2)C3)o1 |
| InChI | InChI=1S/C15H22N2O/c1-10-16-17-12(18-10)15-6-11-4-13(2,8-15)7-14(3,5-11)9-15/h11H,4-9H2,1-3H3 |
| InChIKey | UXTPMPPLDFAJOK-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |