C22H21N3O5 — CID 19553169
(E)-1-(2-ethylpyrazol-3-yl)-3-[3-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]prop-2-en-1-one (PubChem CID 19553169) has the molecular formula C22H21N3O5 and a molecular weight of 407.43 g/mol. Its IUPAC name is (E)-1-(2-ethylpyrazol-3-yl)-3-[3-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(2-ethylpyrazol-3-yl)-3-[3-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19553169 |
| Molecular Formula | C22H21N3O5 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | (E)-1-(2-ethylpyrazol-3-yl)-3-[3-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]prop-2-en-1-one |
| SMILES | CCn1nccc1C(=O)/C=C/c1ccc(OCc2ccc([N+](=O)[O-])cc2)c(OC)c1 |
| InChI | InChI=1S/C22H21N3O5/c1-3-24-19(12-13-23-24)20(26)10-6-16-7-11-21(22(14-16)29-2)30-15-17-4-8-18(9-5-17)25(27)28/h4-14H,3,15H2,1-2H3/b10-6+ |
| InChIKey | FSGLQWJPPJIQDI-UXBLZVDNSA-N |
| XLogP | 4.29 |
| TPSA | 96.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|