C20H38N4O — CID 19555822
N-[1-(dipentylamino)propan-2-yl]-3-(3-methylpyrazol-1-yl)propanamide (PubChem CID 19555822) has the molecular formula C20H38N4O and a molecular weight of 350.55 g/mol. Its IUPAC name is N-[1-(dipentylamino)propan-2-yl]-3-(3-methylpyrazol-1-yl)propanamide.
| Compound Name | N-[1-(dipentylamino)propan-2-yl]-3-(3-methylpyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 19555822 |
| Molecular Formula | C20H38N4O |
| Molecular Weight | 350.55 g/mol |
| Exact Mass | 350.30 |
| IUPAC Name | N-[1-(dipentylamino)propan-2-yl]-3-(3-methylpyrazol-1-yl)propanamide |
| SMILES | CCCCCN(CCCCC)CC(C)NC(=O)CCn1ccc(C)n1 |
| InChI | InChI=1S/C20H38N4O/c1-5-7-9-13-23(14-10-8-6-2)17-19(4)21-20(25)12-16-24-15-11-18(3)22-24/h11,15,19H,5-10,12-14,16-17H2,1-4H3,(H,21,25) |
| InChIKey | VVSAXOVFCOEQIO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.55 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|