C18H18O2 — CID 19557375
(2E,4E)-5-(furan-2-yl)-1-(4-propan-2-ylphenyl)penta-2,4-dien-1-one (PubChem CID 19557375) has the molecular formula C18H18O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is (2E,4E)-5-(furan-2-yl)-1-(4-propan-2-ylphenyl)penta-2,4-dien-1-one.
| Compound Name | (2E,4E)-5-(furan-2-yl)-1-(4-propan-2-ylphenyl)penta-2,4-dien-1-one |
|---|---|
| PubChem CID | 19557375 |
| Molecular Formula | C18H18O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | (2E,4E)-5-(furan-2-yl)-1-(4-propan-2-ylphenyl)penta-2,4-dien-1-one |
| SMILES | CC(C)c1ccc(C(=O)/C=C/C=C/c2ccco2)cc1 |
| InChI | InChI=1S/C18H18O2/c1-14(2)15-9-11-16(12-10-15)18(19)8-4-3-6-17-7-5-13-20-17/h3-14H,1-2H3/b6-3+,8-4+ |
| InChIKey | RDPPOCVSFOBARC-PHQNLGIASA-N |
| XLogP | 4.86 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|