C15H20N6O5 — CID 19557921
methyl 4-[3-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoylamino]-1-ethylpyrazole-3-carboxylate (PubChem CID 19557921) has the molecular formula C15H20N6O5 and a molecular weight of 364.36 g/mol. Its IUPAC name is methyl 4-[3-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoylamino]-1-ethylpyrazole-3-carboxylate.
| Compound Name | methyl 4-[3-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoylamino]-1-ethylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 19557921 |
| Molecular Formula | C15H20N6O5 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | methyl 4-[3-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoylamino]-1-ethylpyrazole-3-carboxylate |
| SMILES | CCn1cc(NC(=O)CCn2nc(C)c([N+](=O)[O-])c2C)c(C(=O)OC)n1 |
| InChI | InChI=1S/C15H20N6O5/c1-5-19-8-11(13(18-19)15(23)26-4)16-12(22)6-7-20-10(3)14(21(24)25)9(2)17-20/h8H,5-7H2,1-4H3,(H,16,22) |
| InChIKey | DEDOZSHJCYZHSU-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 134.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|