C14H20IN5O — CID 19558406
N-[(1-ethylpyrazol-3-yl)methyl]-3-(4-iodo-5-methylpyrazol-1-yl)-N-methylpropanamide (PubChem CID 19558406) has the molecular formula C14H20IN5O and a molecular weight of 401.25 g/mol. Its IUPAC name is N-[(1-ethylpyrazol-3-yl)methyl]-3-(4-iodo-5-methylpyrazol-1-yl)-N-methylpropanamide.
| Compound Name | N-[(1-ethylpyrazol-3-yl)methyl]-3-(4-iodo-5-methylpyrazol-1-yl)-N-methylpropanamide |
|---|---|
| PubChem CID | 19558406 |
| Molecular Formula | C14H20IN5O |
| Molecular Weight | 401.25 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | N-[(1-ethylpyrazol-3-yl)methyl]-3-(4-iodo-5-methylpyrazol-1-yl)-N-methylpropanamide |
| SMILES | CCn1ccc(CN(C)C(=O)CCn2ncc(I)c2C)n1 |
| InChI | InChI=1S/C14H20IN5O/c1-4-19-7-5-12(17-19)10-18(3)14(21)6-8-20-11(2)13(15)9-16-20/h5,7,9H,4,6,8,10H2,1-3H3 |
| InChIKey | YBAFNYKJWMAGBY-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 55.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.25 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|