C25H26N4O4 — CID 19560756
(E)-3-[4-methoxy-3-[(4-nitropyrazol-1-yl)methyl]phenyl]-1-(4-piperidin-1-ylphenyl)prop-2-en-1-one (PubChem CID 19560756) has the molecular formula C25H26N4O4 and a molecular weight of 446.51 g/mol. Its IUPAC name is (E)-3-[4-methoxy-3-[(4-nitropyrazol-1-yl)methyl]phenyl]-1-(4-piperidin-1-ylphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[4-methoxy-3-[(4-nitropyrazol-1-yl)methyl]phenyl]-1-(4-piperidin-1-ylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19560756 |
| Molecular Formula | C25H26N4O4 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | (E)-3-[4-methoxy-3-[(4-nitropyrazol-1-yl)methyl]phenyl]-1-(4-piperidin-1-ylphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc(N3CCCCC3)cc2)cc1Cn1cc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C25H26N4O4/c1-33-25-12-6-19(15-21(25)17-28-18-23(16-26-28)29(31)32)5-11-24(30)20-7-9-22(10-8-20)27-13-3-2-4-14-27/h5-12,15-16,18H,2-4,13-14,17H2,1H3/b11-5+ |
| InChIKey | YBTMSDGADDYMMJ-VZUCSPMQSA-N |
| XLogP | 4.73 |
| TPSA | 90.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|