C17H21N5O6S — CID 19562503
2-methyl-N-(4-morpholin-4-ylsulfonylphenyl)-3-(4-nitropyrazol-1-yl)propanamide (PubChem CID 19562503) has the molecular formula C17H21N5O6S and a molecular weight of 423.45 g/mol. Its IUPAC name is 2-methyl-N-(4-morpholin-4-ylsulfonylphenyl)-3-(4-nitropyrazol-1-yl)propanamide.
| Compound Name | 2-methyl-N-(4-morpholin-4-ylsulfonylphenyl)-3-(4-nitropyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 19562503 |
| Molecular Formula | C17H21N5O6S |
| Molecular Weight | 423.45 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 2-methyl-N-(4-morpholin-4-ylsulfonylphenyl)-3-(4-nitropyrazol-1-yl)propanamide |
| SMILES | CC(Cn1cc([N+](=O)[O-])cn1)C(=O)Nc1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C17H21N5O6S/c1-13(11-20-12-15(10-18-20)22(24)25)17(23)19-14-2-4-16(5-3-14)29(26,27)21-6-8-28-9-7-21/h2-5,10,12-13H,6-9,11H2,1H3,(H,19,23) |
| InChIKey | YGEAGHWMUAJPGC-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 136.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.45 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|