C10H11F3N2O — CID 19563438
(E)-1-(1-ethylpyrazol-3-yl)-5,5,5-trifluoropent-2-en-1-one (PubChem CID 19563438) has the molecular formula C10H11F3N2O and a molecular weight of 232.21 g/mol. Its IUPAC name is (E)-1-(1-ethylpyrazol-3-yl)-5,5,5-trifluoropent-2-en-1-one.
| Compound Name | (E)-1-(1-ethylpyrazol-3-yl)-5,5,5-trifluoropent-2-en-1-one |
|---|---|
| PubChem CID | 19563438 |
| Molecular Formula | C10H11F3N2O |
| Molecular Weight | 232.21 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | (E)-1-(1-ethylpyrazol-3-yl)-5,5,5-trifluoropent-2-en-1-one |
| SMILES | CCn1ccc(C(=O)/C=C/CC(F)(F)F)n1 |
| InChI | InChI=1S/C10H11F3N2O/c1-2-15-7-5-8(14-15)9(16)4-3-6-10(11,12)13/h3-5,7H,2,6H2,1H3/b4-3+ |
| InChIKey | PTRQIOWNRKSTMS-ONEGZZNKSA-N |
| XLogP | 2.59 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.21 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|