C9H9F3N2O — CID 19565437
(E)-5,5,5-trifluoro-1-(1-methylpyrazol-3-yl)pent-2-en-1-one (PubChem CID 19565437) has the molecular formula C9H9F3N2O and a molecular weight of 218.18 g/mol. Its IUPAC name is (E)-5,5,5-trifluoro-1-(1-methylpyrazol-3-yl)pent-2-en-1-one.
| Compound Name | (E)-5,5,5-trifluoro-1-(1-methylpyrazol-3-yl)pent-2-en-1-one |
|---|---|
| PubChem CID | 19565437 |
| Molecular Formula | C9H9F3N2O |
| Molecular Weight | 218.18 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | (E)-5,5,5-trifluoro-1-(1-methylpyrazol-3-yl)pent-2-en-1-one |
| SMILES | Cn1ccc(C(=O)/C=C/CC(F)(F)F)n1 |
| InChI | InChI=1S/C9H9F3N2O/c1-14-6-4-7(13-14)8(15)3-2-5-9(10,11)12/h2-4,6H,5H2,1H3/b3-2+ |
| InChIKey | QXSVLJNZEYRDFH-NSCUHMNNSA-N |
| XLogP | 2.11 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.18 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|