C19H22F3N3O — CID 19570652
3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]-2-methyl-N-(1-phenylethyl)propanamide (PubChem CID 19570652) has the molecular formula C19H22F3N3O and a molecular weight of 365.40 g/mol. Its IUPAC name is 3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]-2-methyl-N-(1-phenylethyl)propanamide.
| Compound Name | 3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]-2-methyl-N-(1-phenylethyl)propanamide |
|---|---|
| PubChem CID | 19570652 |
| Molecular Formula | C19H22F3N3O |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]-2-methyl-N-(1-phenylethyl)propanamide |
| SMILES | CC(Cn1nc(C(F)(F)F)cc1C1CC1)C(=O)NC(C)c1ccccc1 |
| InChI | InChI=1S/C19H22F3N3O/c1-12(18(26)23-13(2)14-6-4-3-5-7-14)11-25-16(15-8-9-15)10-17(24-25)19(20,21)22/h3-7,10,12-13,15H,8-9,11H2,1-2H3,(H,23,26) |
| InChIKey | LOISOIQRKPLVKT-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |