C28H29N7O — CID 19571439
3,5-dimethyl-4-[3-[(10-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl)methyl]-1-adamantyl]-1,2-oxazole (PubChem CID 19571439) has the molecular formula C28H29N7O and a molecular weight of 479.59 g/mol. Its IUPAC name is 3,5-dimethyl-4-[3-[(10-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl)methyl]-1-adamantyl]-1,2-oxazole.
| Compound Name | 3,5-dimethyl-4-[3-[(10-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl)methyl]-1-adamantyl]-1,2-oxazole |
|---|---|
| PubChem CID | 19571439 |
| Molecular Formula | C28H29N7O |
| Molecular Weight | 479.59 g/mol |
| Exact Mass | 479.24 |
| IUPAC Name | 3,5-dimethyl-4-[3-[(10-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl)methyl]-1-adamantyl]-1,2-oxazole |
| SMILES | Cc1noc(C)c1C12CC3CC(CC(Cc4nc5c6cnn(-c7ccccc7)c6ncn5n4)(C3)C1)C2 |
| InChI | InChI=1S/C28H29N7O/c1-17-24(18(2)36-33-17)28-11-19-8-20(12-28)10-27(9-19,15-28)13-23-31-26-22-14-30-35(21-6-4-3-5-7-21)25(22)29-16-34(26)32-23/h3-7,14,16,19-20H,8-13,15H2,1-2H3 |
| InChIKey | WQQIUPYYCUYTGQ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 86.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.59 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |