C25H17N9 — CID 19573430
4-(7-methyl-5-phenylpyrazolo[1,5-a]pyrimidin-3-yl)-10-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 19573430) has the molecular formula C25H17N9 and a molecular weight of 443.47 g/mol. Its IUPAC name is 4-(7-methyl-5-phenylpyrazolo[1,5-a]pyrimidin-3-yl)-10-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 4-(7-methyl-5-phenylpyrazolo[1,5-a]pyrimidin-3-yl)-10-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 19573430 |
| Molecular Formula | C25H17N9 |
| Molecular Weight | 443.47 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | 4-(7-methyl-5-phenylpyrazolo[1,5-a]pyrimidin-3-yl)-10-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | Cc1cc(-c2ccccc2)nc2c(-c3nc4c5cnn(-c6ccccc6)c5ncn4n3)cnn12 |
| InChI | InChI=1S/C25H17N9/c1-16-12-21(17-8-4-2-5-9-17)29-25-19(13-27-33(16)25)22-30-24-20-14-28-34(18-10-6-3-7-11-18)23(20)26-15-32(24)31-22/h2-15H,1H3 |
| InChIKey | WZVQRWBURABCBC-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 91.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.47 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |