C21H22N4O5 — CID 19574757
3-[(4-ethoxyphenoxy)methyl]-N-[2-(4-nitropyrazol-1-yl)ethyl]benzamide (PubChem CID 19574757) has the molecular formula C21H22N4O5 and a molecular weight of 410.43 g/mol. Its IUPAC name is 3-[(4-ethoxyphenoxy)methyl]-N-[2-(4-nitropyrazol-1-yl)ethyl]benzamide.
| Compound Name | 3-[(4-ethoxyphenoxy)methyl]-N-[2-(4-nitropyrazol-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 19574757 |
| Molecular Formula | C21H22N4O5 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 3-[(4-ethoxyphenoxy)methyl]-N-[2-(4-nitropyrazol-1-yl)ethyl]benzamide |
| SMILES | CCOc1ccc(OCc2cccc(C(=O)NCCn3cc([N+](=O)[O-])cn3)c2)cc1 |
| InChI | InChI=1S/C21H22N4O5/c1-2-29-19-6-8-20(9-7-19)30-15-16-4-3-5-17(12-16)21(26)22-10-11-24-14-18(13-23-24)25(27)28/h3-9,12-14H,2,10-11,15H2,1H3,(H,22,26) |
| InChIKey | ZMGBGYWJOARTNS-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|