C16H24N4O4S — CID 19574848
methyl 2-[[2-(6-amino-4-oxo-1-prop-2-enylpyrimidin-2-yl)sulfanylacetyl]amino]-4-methylpentanoate (PubChem CID 19574848) has the molecular formula C16H24N4O4S and a molecular weight of 368.46 g/mol. Its IUPAC name is methyl 2-[[2-(6-amino-4-oxo-1-prop-2-enylpyrimidin-2-yl)sulfanylacetyl]amino]-4-methylpentanoate.
| Compound Name | methyl 2-[[2-(6-amino-4-oxo-1-prop-2-enylpyrimidin-2-yl)sulfanylacetyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 19574848 |
| Molecular Formula | C16H24N4O4S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | methyl 2-[[2-(6-amino-4-oxo-1-prop-2-enylpyrimidin-2-yl)sulfanylacetyl]amino]-4-methylpentanoate |
| SMILES | C=CCn1c(N)cc(=O)nc1SCC(=O)NC(CC(C)C)C(=O)OC |
| InChI | InChI=1S/C16H24N4O4S/c1-5-6-20-12(17)8-13(21)19-16(20)25-9-14(22)18-11(7-10(2)3)15(23)24-4/h5,8,10-11H,1,6-7,9,17H2,2-4H3,(H,18,22) |
| InChIKey | IMXNTAJAWYKQQQ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 116.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|