C23H15F2N5O4S — CID 19575122
(7E)-3-(difluoromethyl)-7-[[5-[(4-nitrophenoxy)methyl]furan-2-yl]methylidene]-6-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine (PubChem CID 19575122) has the molecular formula C23H15F2N5O4S and a molecular weight of 495.47 g/mol. Its IUPAC name is (7E)-3-(difluoromethyl)-7-[[5-[(4-nitrophenoxy)methyl]furan-2-yl]methylidene]-6-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine.
| Compound Name | (7E)-3-(difluoromethyl)-7-[[5-[(4-nitrophenoxy)methyl]furan-2-yl]methylidene]-6-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine |
|---|---|
| PubChem CID | 19575122 |
| Molecular Formula | C23H15F2N5O4S |
| Molecular Weight | 495.47 g/mol |
| Exact Mass | 495.08 |
| IUPAC Name | (7E)-3-(difluoromethyl)-7-[[5-[(4-nitrophenoxy)methyl]furan-2-yl]methylidene]-6-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine |
| SMILES | O=[N+]([O-])c1ccc(OCc2ccc(/C=C3/Sc4nnc(C(F)F)n4N=C3c3ccccc3)o2)cc1 |
| InChI | InChI=1S/C23H15F2N5O4S/c24-21(25)22-26-27-23-29(22)28-20(14-4-2-1-3-5-14)19(35-23)12-17-10-11-18(34-17)13-33-16-8-6-15(7-9-16)30(31)32/h1-12,21H,13H2/b19-12+ |
| InChIKey | OZRCFJDTUWLAQA-XDHOZWIPSA-N |
| XLogP | 5.70 |
| TPSA | 108.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.47 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|