About 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-1-(4-ethylpiperazin-1-yl)propan-1-one
3-(4-bromo-3,5-dimethylpyrazol-1-yl)-1-(4-ethylpiperazin-1-yl)propan-1-one (PubChem CID 19575721) has the molecular formula C14H23BrN4O
and a molecular weight of 343.27 g/mol. Its IUPAC name is 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-1-(4-ethylpiperazin-1-yl)propan-1-one.
Molecular Properties
| Compound Name | 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-1-(4-ethylpiperazin-1-yl)propan-1-one |
| PubChem CID | 19575721 |
| Molecular Formula | C14H23BrN4O |
| Molecular Weight | 343.27 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-1-(4-ethylpiperazin-1-yl)propan-1-one |
| SMILES | CCN1CCN(C(=O)CCn2nc(C)c(Br)c2C)CC1 |
| InChI | InChI=1S/C14H23BrN4O/c1-4-17-7-9-18(10-8-17)13(20)5-6-19-12(3)14(15)11(2)16-19/h4-10H2,1-3H3 |
| InChIKey | XMZOIWYJVPWNEZ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.27 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-1-(4-ethylpiperazin-1-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-1-(4-ethylpiperazin-1-yl)propan-1-one?
The IUPAC name of 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-1-(4-ethylpiperazin-1-yl)propan-1-one (CID 19575721) is 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-1-(4-ethylpiperazin-1-yl)propan-1-one.
What is the SMILES notation for 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-1-(4-ethylpiperazin-1-yl)propan-1-one?
The canonical SMILES for 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-1-(4-ethylpiperazin-1-yl)propan-1-one is CCN1CCN(C(=O)CCn2nc(C)c(Br)c2C)CC1.
What is the InChIKey of 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-1-(4-ethylpiperazin-1-yl)propan-1-one?
The InChIKey is XMZOIWYJVPWNEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23BrN4O/c1-4-17-7-9-18(10-8-17)13(20)5-6-19-12(3)14(15)11(2)16-19/h4-10H2,1-3H3.
What are the key properties of 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-1-(4-ethylpiperazin-1-yl)propan-1-one?
3-(4-bromo-3,5-dimethylpyrazol-1-yl)-1-(4-ethylpiperazin-1-yl)propan-1-one has a molecular weight of 343.27 g/mol, XLogP of 1.82, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-1-(4-ethylpiperazin-1-yl)propan-1-one is sourced from PubChem (CID 19575721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).