C13H17NO5S — CID 19576217
2-(2,4,5-trimethoxyphenyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 19576217) has the molecular formula C13H17NO5S and a molecular weight of 299.35 g/mol. Its IUPAC name is 2-(2,4,5-trimethoxyphenyl)-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | 2-(2,4,5-trimethoxyphenyl)-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 19576217 |
| Molecular Formula | C13H17NO5S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 2-(2,4,5-trimethoxyphenyl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | COc1cc(OC)c(C2NC(C(=O)O)CS2)cc1OC |
| InChI | InChI=1S/C13H17NO5S/c1-17-9-5-11(19-3)10(18-2)4-7(9)12-14-8(6-20-12)13(15)16/h4-5,8,12,14H,6H2,1-3H3,(H,15,16) |
| InChIKey | AHSDXQPOASYLGD-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |