About 1-morpholin-4-yl-2,2-bis(trifluoromethyl)butan-1-one
1-morpholin-4-yl-2,2-bis(trifluoromethyl)butan-1-one (PubChem CID 19577291) has the molecular formula C10H13F6NO2
and a molecular weight of 293.21 g/mol. Its IUPAC name is 1-morpholin-4-yl-2,2-bis(trifluoromethyl)butan-1-one.
Molecular Properties
| Compound Name | 1-morpholin-4-yl-2,2-bis(trifluoromethyl)butan-1-one |
| PubChem CID | 19577291 |
| Molecular Formula | C10H13F6NO2 |
| Molecular Weight | 293.21 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 1-morpholin-4-yl-2,2-bis(trifluoromethyl)butan-1-one |
| SMILES | CCC(C(=O)N1CCOCC1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H13F6NO2/c1-2-8(9(11,12)13,10(14,15)16)7(18)17-3-5-19-6-4-17/h2-6H2,1H3 |
| InChIKey | SDNWXRNEYAERFY-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.21 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-morpholin-4-yl-2,2-bis(trifluoromethyl)butan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-morpholin-4-yl-2,2-bis(trifluoromethyl)butan-1-one?
The IUPAC name of 1-morpholin-4-yl-2,2-bis(trifluoromethyl)butan-1-one (CID 19577291) is 1-morpholin-4-yl-2,2-bis(trifluoromethyl)butan-1-one.
What is the SMILES notation for 1-morpholin-4-yl-2,2-bis(trifluoromethyl)butan-1-one?
The canonical SMILES for 1-morpholin-4-yl-2,2-bis(trifluoromethyl)butan-1-one is CCC(C(=O)N1CCOCC1)(C(F)(F)F)C(F)(F)F.
What is the InChIKey of 1-morpholin-4-yl-2,2-bis(trifluoromethyl)butan-1-one?
The InChIKey is SDNWXRNEYAERFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13F6NO2/c1-2-8(9(11,12)13,10(14,15)16)7(18)17-3-5-19-6-4-17/h2-6H2,1H3.
What are the key properties of 1-morpholin-4-yl-2,2-bis(trifluoromethyl)butan-1-one?
1-morpholin-4-yl-2,2-bis(trifluoromethyl)butan-1-one has a molecular weight of 293.21 g/mol, XLogP of 2.37, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-morpholin-4-yl-2,2-bis(trifluoromethyl)butan-1-one is sourced from PubChem (CID 19577291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).