About 5-[(1,3-dimethylpyrazol-4-yl)methyl-methylamino]-5-oxopentanoic acid
5-[(1,3-dimethylpyrazol-4-yl)methyl-methylamino]-5-oxopentanoic acid (PubChem CID 19577798) has the molecular formula C12H19N3O3
and a molecular weight of 253.30 g/mol. Its IUPAC name is 5-[(1,3-dimethylpyrazol-4-yl)methyl-methylamino]-5-oxopentanoic acid.
Molecular Properties
| Compound Name | 5-[(1,3-dimethylpyrazol-4-yl)methyl-methylamino]-5-oxopentanoic acid |
| PubChem CID | 19577798 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 5-[(1,3-dimethylpyrazol-4-yl)methyl-methylamino]-5-oxopentanoic acid |
| SMILES | Cc1nn(C)cc1CN(C)C(=O)CCCC(=O)O |
| InChI | InChI=1S/C12H19N3O3/c1-9-10(8-15(3)13-9)7-14(2)11(16)5-4-6-12(17)18/h8H,4-7H2,1-3H3,(H,17,18) |
| InChIKey | FIFVWOQLKJSHKH-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(1,3-dimethylpyrazol-4-yl)methyl-methylamino]-5-oxopentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1,3-dimethylpyrazol-4-yl)methyl-methylamino]-5-oxopentanoic acid?
The IUPAC name of 5-[(1,3-dimethylpyrazol-4-yl)methyl-methylamino]-5-oxopentanoic acid (CID 19577798) is 5-[(1,3-dimethylpyrazol-4-yl)methyl-methylamino]-5-oxopentanoic acid.
What is the SMILES notation for 5-[(1,3-dimethylpyrazol-4-yl)methyl-methylamino]-5-oxopentanoic acid?
The canonical SMILES for 5-[(1,3-dimethylpyrazol-4-yl)methyl-methylamino]-5-oxopentanoic acid is Cc1nn(C)cc1CN(C)C(=O)CCCC(=O)O.
What is the InChIKey of 5-[(1,3-dimethylpyrazol-4-yl)methyl-methylamino]-5-oxopentanoic acid?
The InChIKey is FIFVWOQLKJSHKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O3/c1-9-10(8-15(3)13-9)7-14(2)11(16)5-4-6-12(17)18/h8H,4-7H2,1-3H3,(H,17,18).
What are the key properties of 5-[(1,3-dimethylpyrazol-4-yl)methyl-methylamino]-5-oxopentanoic acid?
5-[(1,3-dimethylpyrazol-4-yl)methyl-methylamino]-5-oxopentanoic acid has a molecular weight of 253.30 g/mol, XLogP of 0.94, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1,3-dimethylpyrazol-4-yl)methyl-methylamino]-5-oxopentanoic acid is sourced from PubChem (CID 19577798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).