C22H23ClN2O6 — CID 19578779
diethyl 2-[[2-[4-[(4-chlorophenyl)methoxy]benzoyl]hydrazinyl]methylidene]propanedioate (PubChem CID 19578779) has the molecular formula C22H23ClN2O6 and a molecular weight of 446.89 g/mol. Its IUPAC name is diethyl 2-[[2-[4-[(4-chlorophenyl)methoxy]benzoyl]hydrazinyl]methylidene]propanedioate.
| Compound Name | diethyl 2-[[2-[4-[(4-chlorophenyl)methoxy]benzoyl]hydrazinyl]methylidene]propanedioate |
|---|---|
| PubChem CID | 19578779 |
| Molecular Formula | C22H23ClN2O6 |
| Molecular Weight | 446.89 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | diethyl 2-[[2-[4-[(4-chlorophenyl)methoxy]benzoyl]hydrazinyl]methylidene]propanedioate |
| SMILES | CCOC(=O)C(=CNNC(=O)c1ccc(OCc2ccc(Cl)cc2)cc1)C(=O)OCC |
| InChI | InChI=1S/C22H23ClN2O6/c1-3-29-21(27)19(22(28)30-4-2)13-24-25-20(26)16-7-11-18(12-8-16)31-14-15-5-9-17(23)10-6-15/h5-13,24H,3-4,14H2,1-2H3,(H,25,26) |
| InChIKey | UIGFBYAOCDPFGW-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.89 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|