C22H36N2 — CID 19578940
(2R,5R)-1-[2-[(2S,5R)-2,5-bis(prop-2-enyl)pyrrolidin-1-yl]ethyl]-2,5-bis(prop-2-enyl)pyrrolidine (PubChem CID 19578940) has the molecular formula C22H36N2 and a molecular weight of 328.54 g/mol. Its IUPAC name is (2R,5R)-1-[2-[(2S,5R)-2,5-bis(prop-2-enyl)pyrrolidin-1-yl]ethyl]-2,5-bis(prop-2-enyl)pyrrolidine.
| Compound Name | (2R,5R)-1-[2-[(2S,5R)-2,5-bis(prop-2-enyl)pyrrolidin-1-yl]ethyl]-2,5-bis(prop-2-enyl)pyrrolidine |
|---|---|
| PubChem CID | 19578940 |
| Molecular Formula | C22H36N2 |
| Molecular Weight | 328.54 g/mol |
| Exact Mass | 328.29 |
| IUPAC Name | (2R,5R)-1-[2-[(2S,5R)-2,5-bis(prop-2-enyl)pyrrolidin-1-yl]ethyl]-2,5-bis(prop-2-enyl)pyrrolidine |
| SMILES | C=CC[C@@H]1CC[C@H](CC=C)N1CCN1[C@@H](CC=C)CC[C@@H]1CC=C |
| InChI | InChI=1S/C22H36N2/c1-5-9-19-13-14-20(10-6-2)23(19)17-18-24-21(11-7-3)15-16-22(24)12-8-4/h5-8,19-22H,1-4,9-18H2/t19-,20-,21-,22+/m0/s1 |
| InChIKey | YACONMHDXMIHKP-MYGLTJDJSA-N |
| XLogP | 4.96 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.54 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|