C17H21BrN2O3S — CID 19579103
1-[4-(2-bromo-4,5-diethoxyphenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]ethanone (PubChem CID 19579103) has the molecular formula C17H21BrN2O3S and a molecular weight of 413.34 g/mol. Its IUPAC name is 1-[4-(2-bromo-4,5-diethoxyphenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]ethanone.
| Compound Name | 1-[4-(2-bromo-4,5-diethoxyphenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]ethanone |
|---|---|
| PubChem CID | 19579103 |
| Molecular Formula | C17H21BrN2O3S |
| Molecular Weight | 413.34 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | 1-[4-(2-bromo-4,5-diethoxyphenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]ethanone |
| SMILES | CCOc1cc(Br)c(C2NC(=S)NC(C)=C2C(C)=O)cc1OCC |
| InChI | InChI=1S/C17H21BrN2O3S/c1-5-22-13-7-11(12(18)8-14(13)23-6-2)16-15(10(4)21)9(3)19-17(24)20-16/h7-8,16H,5-6H2,1-4H3,(H2,19,20,24) |
| InChIKey | CJRZRPXTEHKCPX-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.34 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|