C23H22Cl2N4O2 — CID 19579639
3-[[1-[(3,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]amino]-1-(3-methylphenyl)pyrrolidine-2,5-dione (PubChem CID 19579639) has the molecular formula C23H22Cl2N4O2 and a molecular weight of 457.36 g/mol. Its IUPAC name is 3-[[1-[(3,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]amino]-1-(3-methylphenyl)pyrrolidine-2,5-dione.
| Compound Name | 3-[[1-[(3,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]amino]-1-(3-methylphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 19579639 |
| Molecular Formula | C23H22Cl2N4O2 |
| Molecular Weight | 457.36 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | 3-[[1-[(3,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]amino]-1-(3-methylphenyl)pyrrolidine-2,5-dione |
| SMILES | Cc1cccc(N2C(=O)CC(Nc3c(C)nn(Cc4ccc(Cl)c(Cl)c4)c3C)C2=O)c1 |
| InChI | InChI=1S/C23H22Cl2N4O2/c1-13-5-4-6-17(9-13)29-21(30)11-20(23(29)31)26-22-14(2)27-28(15(22)3)12-16-7-8-18(24)19(25)10-16/h4-10,20,26H,11-12H2,1-3H3 |
| InChIKey | FQGFXKFWGQVKPU-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.36 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|