C23H23N3O — CID 19579885
4-(anilinomethyl)-N-[1-(4-methylphenyl)ethylideneamino]benzamide (PubChem CID 19579885) has the molecular formula C23H23N3O and a molecular weight of 357.46 g/mol. Its IUPAC name is 4-(anilinomethyl)-N-[1-(4-methylphenyl)ethylideneamino]benzamide.
| Compound Name | 4-(anilinomethyl)-N-[1-(4-methylphenyl)ethylideneamino]benzamide |
|---|---|
| PubChem CID | 19579885 |
| Molecular Formula | C23H23N3O |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | 4-(anilinomethyl)-N-[1-(4-methylphenyl)ethylideneamino]benzamide |
| SMILES | CC(=NNC(=O)c1ccc(CNc2ccccc2)cc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H23N3O/c1-17-8-12-20(13-9-17)18(2)25-26-23(27)21-14-10-19(11-15-21)16-24-22-6-4-3-5-7-22/h3-15,24H,16H2,1-2H3,(H,26,27) |
| InChIKey | KTFGAPWGMDSPSS-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|