C14H15N5O6 — CID 19580192
2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(2-methoxy-4-nitrophenyl)acetamide (PubChem CID 19580192) has the molecular formula C14H15N5O6 and a molecular weight of 349.30 g/mol. Its IUPAC name is 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(2-methoxy-4-nitrophenyl)acetamide.
| Compound Name | 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(2-methoxy-4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 19580192 |
| Molecular Formula | C14H15N5O6 |
| Molecular Weight | 349.30 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(2-methoxy-4-nitrophenyl)acetamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)Cn1nc(C)c([N+](=O)[O-])c1C |
| InChI | InChI=1S/C14H15N5O6/c1-8-14(19(23)24)9(2)17(16-8)7-13(20)15-11-5-4-10(18(21)22)6-12(11)25-3/h4-6H,7H2,1-3H3,(H,15,20) |
| InChIKey | GICWWPXZWJFTSA-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 142.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.30 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|