C17H13F5N4O — CID 19580482
(4E)-4-[(1,5-dimethylpyrazol-3-yl)methylidene]-5-(1,1,2,2,2-pentafluoroethyl)-2-phenylpyrazol-3-one (PubChem CID 19580482) has the molecular formula C17H13F5N4O and a molecular weight of 384.31 g/mol. Its IUPAC name is (4E)-4-[(1,5-dimethylpyrazol-3-yl)methylidene]-5-(1,1,2,2,2-pentafluoroethyl)-2-phenylpyrazol-3-one.
| Compound Name | (4E)-4-[(1,5-dimethylpyrazol-3-yl)methylidene]-5-(1,1,2,2,2-pentafluoroethyl)-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 19580482 |
| Molecular Formula | C17H13F5N4O |
| Molecular Weight | 384.31 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | (4E)-4-[(1,5-dimethylpyrazol-3-yl)methylidene]-5-(1,1,2,2,2-pentafluoroethyl)-2-phenylpyrazol-3-one |
| SMILES | Cc1cc(/C=C2/C(=O)N(c3ccccc3)N=C2C(F)(F)C(F)(F)F)nn1C |
| InChI | InChI=1S/C17H13F5N4O/c1-10-8-11(23-25(10)2)9-13-14(16(18,19)17(20,21)22)24-26(15(13)27)12-6-4-3-5-7-12/h3-9H,1-2H3/b13-9+ |
| InChIKey | OMFWHYZSLFSCPC-UKTHLTGXSA-N |
| XLogP | 3.71 |
| TPSA | 50.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.31 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|