C19H18N6O3S — CID 19580650
N,N-diethyl-12-methyl-4-(2-nitrophenyl)-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene-11-carboxamide (PubChem CID 19580650) has the molecular formula C19H18N6O3S and a molecular weight of 410.46 g/mol. Its IUPAC name is N,N-diethyl-12-methyl-4-(2-nitrophenyl)-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene-11-carboxamide.
| Compound Name | N,N-diethyl-12-methyl-4-(2-nitrophenyl)-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene-11-carboxamide |
|---|---|
| PubChem CID | 19580650 |
| Molecular Formula | C19H18N6O3S |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | N,N-diethyl-12-methyl-4-(2-nitrophenyl)-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene-11-carboxamide |
| SMILES | CCN(CC)C(=O)c1sc2ncn3nc(-c4ccccc4[N+](=O)[O-])nc3c2c1C |
| InChI | InChI=1S/C19H18N6O3S/c1-4-23(5-2)19(26)15-11(3)14-17-21-16(22-24(17)10-20-18(14)29-15)12-8-6-7-9-13(12)25(27)28/h6-10H,4-5H2,1-3H3 |
| InChIKey | BXIVBTSGNNEIOD-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 106.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|